C24H31N3O6 — CID 17356770
N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)acetohydrazide (PubChem CID 17356770) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)acetohydrazide.
| Compound Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 17356770 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N'-[2-(2,4-ditert-butylphenoxy)acetyl]-2-(4-nitrophenoxy)acetohydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)COc2ccc([N+](=O)[O-])cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31N3O6/c1-23(2,3)16-7-12-20(19(13-16)24(4,5)6)33-15-22(29)26-25-21(28)14-32-18-10-8-17(9-11-18)27(30)31/h7-13H,14-15H2,1-6H3,(H,25,28)(H,26,29) |
| InChIKey | CRNCSIOTCXZIKG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|