C30H42N4O6 — CID 3322788
1-N',6-N'-bis[2-(4-tert-butylphenoxy)acetyl]hexanedihydrazide (PubChem CID 3322788) has the molecular formula C30H42N4O6 and a molecular weight of 554.69 g/mol. Its IUPAC name is 1-N',6-N'-bis[2-(4-tert-butylphenoxy)acetyl]hexanedihydrazide.
| Compound Name | 1-N',6-N'-bis[2-(4-tert-butylphenoxy)acetyl]hexanedihydrazide |
|---|---|
| PubChem CID | 3322788 |
| Molecular Formula | C30H42N4O6 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 1-N',6-N'-bis[2-(4-tert-butylphenoxy)acetyl]hexanedihydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)CCCCC(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H42N4O6/c1-29(2,3)21-11-15-23(16-12-21)39-19-27(37)33-31-25(35)9-7-8-10-26(36)32-34-28(38)20-40-24-17-13-22(14-18-24)30(4,5)6/h11-18H,7-10,19-20H2,1-6H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | MTWAHZRFANCIFI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|