C27H36N4O8 — CID 3303798
1-N',9-N'-bis[2-(4-methoxyphenoxy)acetyl]nonanedihydrazide (PubChem CID 3303798) has the molecular formula C27H36N4O8 and a molecular weight of 544.61 g/mol. Its IUPAC name is 1-N',9-N'-bis[2-(4-methoxyphenoxy)acetyl]nonanedihydrazide.
| Compound Name | 1-N',9-N'-bis[2-(4-methoxyphenoxy)acetyl]nonanedihydrazide |
|---|---|
| PubChem CID | 3303798 |
| Molecular Formula | C27H36N4O8 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 1-N',9-N'-bis[2-(4-methoxyphenoxy)acetyl]nonanedihydrazide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)CCCCCCCC(=O)NNC(=O)COc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H36N4O8/c1-36-20-10-14-22(15-11-20)38-18-26(34)30-28-24(32)8-6-4-3-5-7-9-25(33)29-31-27(35)19-39-23-16-12-21(37-2)13-17-23/h10-17H,3-9,18-19H2,1-2H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35) |
| InChIKey | VXINJEQKNWPOPM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|