C18H19FN2O4 — CID 26929871
N'-[2-(4-fluorophenoxy)acetyl]-3-(4-methoxyphenyl)propanehydrazide (PubChem CID 26929871) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is N'-[2-(4-fluorophenoxy)acetyl]-3-(4-methoxyphenyl)propanehydrazide.
| Compound Name | N'-[2-(4-fluorophenoxy)acetyl]-3-(4-methoxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 26929871 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N'-[2-(4-fluorophenoxy)acetyl]-3-(4-methoxyphenyl)propanehydrazide |
| SMILES | COc1ccc(CCC(=O)NNC(=O)COc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN2O4/c1-24-15-7-2-13(3-8-15)4-11-17(22)20-21-18(23)12-25-16-9-5-14(19)6-10-16/h2-3,5-10H,4,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | PSFYNKMEPIOEAY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|