C18H17FN2O4 — CID 4294808
3-(4-fluorophenyl)-N'-[2-(4-methoxyphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 4294808) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-[2-(4-methoxyphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | 3-(4-fluorophenyl)-N'-[2-(4-methoxyphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 4294808 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-[2-(4-methoxyphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)C=Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H17FN2O4/c1-24-15-7-9-16(10-8-15)25-12-18(23)21-20-17(22)11-4-13-2-5-14(19)6-3-13/h2-11H,12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | QVWCSERBRYLFQQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|