C20H26N2O3 — CID 4958774
N'-(2-naphthalen-2-yloxyacetyl)octanehydrazide (PubChem CID 4958774) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N'-(2-naphthalen-2-yloxyacetyl)octanehydrazide.
| Compound Name | N'-(2-naphthalen-2-yloxyacetyl)octanehydrazide |
|---|---|
| PubChem CID | 4958774 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N'-(2-naphthalen-2-yloxyacetyl)octanehydrazide |
| SMILES | CCCCCCCC(=O)NNC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H26N2O3/c1-2-3-4-5-6-11-19(23)21-22-20(24)15-25-18-13-12-16-9-7-8-10-17(16)14-18/h7-10,12-14H,2-6,11,15H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | TXNNACBQFRHPNX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|