C15H16N2O4 — CID 3108616
2-methoxy-N'-(2-naphthalen-2-yloxyacetyl)acetohydrazide (PubChem CID 3108616) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-methoxy-N'-(2-naphthalen-2-yloxyacetyl)acetohydrazide.
| Compound Name | 2-methoxy-N'-(2-naphthalen-2-yloxyacetyl)acetohydrazide |
|---|---|
| PubChem CID | 3108616 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-methoxy-N'-(2-naphthalen-2-yloxyacetyl)acetohydrazide |
| SMILES | COCC(=O)NNC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16N2O4/c1-20-9-14(18)16-17-15(19)10-21-13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,9-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | YPEPZMFTCMQUJJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|