C16H16N2O5 — CID 8821296
[2-(2-acetylhydrazinyl)-2-oxoethyl] 2-naphthalen-2-yloxyacetate (PubChem CID 8821296) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 8821296 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
| SMILES | CC(=O)NNC(=O)COC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H16N2O5/c1-11(19)17-18-15(20)9-23-16(21)10-22-14-7-6-12-4-2-3-5-13(12)8-14/h2-8H,9-10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | IFZACCJQVOBPRN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|