C21H19NO4 — CID 7843327
[2-(2-methylanilino)-2-oxoethyl] 2-naphthalen-2-yloxyacetate (PubChem CID 7843327) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 7843327 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H19NO4/c1-15-6-2-5-9-19(15)22-20(23)13-26-21(24)14-25-18-11-10-16-7-3-4-8-17(16)12-18/h2-12H,13-14H2,1H3,(H,22,23) |
| InChIKey | GGIGNELORTVFKC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |