C22H18N2O4S — CID 7843288
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate (PubChem CID 7843288) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 7843288 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H18N2O4S/c23-11-12-29-20-8-4-3-7-19(20)24-21(25)14-28-22(26)15-27-18-10-9-16-5-1-2-6-17(16)13-18/h1-10,13H,12,14-15H2,(H,24,25) |
| InChIKey | FXLGDRXJKHPJQF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |