C18H15FN2O3S — CID 8613242
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)acetate (PubChem CID 8613242) has the molecular formula C18H15FN2O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)acetate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8613242 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-fluorophenyl)acetate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O3S/c19-14-7-5-13(6-8-14)11-18(23)24-12-17(22)21-15-3-1-2-4-16(15)25-10-9-20/h1-8H,10-12H2,(H,21,22) |
| InChIKey | JPTURSNBOYMXPL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |