C18H16N2O4S — CID 7485676
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-methoxybenzoate (PubChem CID 7485676) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-methoxybenzoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 7485676 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC(=O)Nc1ccccc1SCC#N |
| InChI | InChI=1S/C18H16N2O4S/c1-23-15-8-4-2-6-13(15)18(22)24-12-17(21)20-14-7-3-5-9-16(14)25-11-10-19/h2-9H,11-12H2,1H3,(H,20,21) |
| InChIKey | PQOWLPFQUKURNQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |