C17H14FN3O5S2 — CID 22830608
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 22830608) has the molecular formula C17H14FN3O5S2 and a molecular weight of 423.45 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 22830608 |
| Molecular Formula | C17H14FN3O5S2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C17H14FN3O5S2/c18-13-6-5-11(28(20,24)25)9-12(13)17(23)26-10-16(22)21-14-3-1-2-4-15(14)27-8-7-19/h1-6,9H,8,10H2,(H,21,22)(H2,20,24,25) |
| InChIKey | AIQCICWNBRIJOM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |