C19H13FN2O3S2 — CID 40674456
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 5-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 40674456) has the molecular formula C19H13FN2O3S2 and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 5-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 5-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 40674456 |
| Molecular Formula | C19H13FN2O3S2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 5-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C19H13FN2O3S2/c20-13-5-6-15-12(9-13)10-17(27-15)19(24)25-11-18(23)22-14-3-1-2-4-16(14)26-8-7-21/h1-6,9-10H,8,11H2,(H,22,23) |
| InChIKey | UGRUYMZAOUDTSJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |