C17H12F2N2O3S — CID 7725739
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 7725739) has the molecular formula C17H12F2N2O3S and a molecular weight of 362.36 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 7725739 |
| Molecular Formula | C17H12F2N2O3S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C17H12F2N2O3S/c18-11-4-3-5-12(19)16(11)17(23)24-10-15(22)21-13-6-1-2-7-14(13)25-9-8-20/h1-7H,9-10H2,(H,21,22) |
| InChIKey | ZPNUKUWOXJRIPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |