C18H16N4O4S — CID 22829667
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(carbamoylamino)benzoate (PubChem CID 22829667) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(carbamoylamino)benzoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 22829667 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(carbamoylamino)benzoate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C18H16N4O4S/c19-8-9-27-15-7-2-1-6-14(15)22-16(23)11-26-17(24)12-4-3-5-13(10-12)21-18(20)25/h1-7,10H,9,11H2,(H,22,23)(H3,20,21,25) |
| InChIKey | YIBSSFYFIUTTHJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |