C24H20N2O3S — CID 7704149
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 7704149) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 7704149 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O3S/c25-14-15-30-22-9-5-4-8-21(22)26-23(27)17-29-24(28)16-18-10-12-20(13-11-18)19-6-2-1-3-7-19/h1-13H,15-17H2,(H,26,27) |
| InChIKey | VGVNYWRHWWSJMT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |