C20H17BrN2O4S — CID 55306369
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate (PubChem CID 55306369) has the molecular formula C20H17BrN2O4S and a molecular weight of 461.34 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55306369 |
| Molecular Formula | C20H17BrN2O4S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)CCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H17BrN2O4S/c21-15-7-5-14(6-8-15)17(24)9-10-20(26)27-13-19(25)23-16-3-1-2-4-18(16)28-12-11-22/h1-8H,9-10,12-13H2,(H,23,25) |
| InChIKey | ORNVZCLPQQMVEM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |