C15H16N2O3S — CID 7717374
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 7717374) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] cyclobutanecarboxylate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 7717374 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)C1CCC1 |
| InChI | InChI=1S/C15H16N2O3S/c16-8-9-21-13-7-2-1-6-12(13)17-14(18)10-20-15(19)11-4-3-5-11/h1-2,6-7,11H,3-5,9-10H2,(H,17,18) |
| InChIKey | NSRWSEDYTQSQJG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |