C18H23N3O3S — CID 8532262
ethyl (3R)-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 8532262) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 8532262 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl (3R)-1-[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CC(=O)Nc2ccccc2SCC#N)C1 |
| InChI | InChI=1S/C18H23N3O3S/c1-2-24-18(23)14-6-5-10-21(12-14)13-17(22)20-15-7-3-4-8-16(15)25-11-9-19/h3-4,7-8,14H,2,5-6,10-13H2,1H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | MRAIJRLTTSWCJK-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |