C17H21N3O3 — CID 8532743
ethyl (3R)-1-[2-(3-cyanoanilino)-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 8532743) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl (3R)-1-[2-(3-cyanoanilino)-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-(3-cyanoanilino)-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 8532743 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | ethyl (3R)-1-[2-(3-cyanoanilino)-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CC(=O)Nc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C17H21N3O3/c1-2-23-17(22)14-6-4-8-20(11-14)12-16(21)19-15-7-3-5-13(9-15)10-18/h3,5,7,9,14H,2,4,6,8,11-12H2,1H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | CRCYJBOSZIKCFF-CQSZACIVSA-N |
| XLogP | 1.77 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |