C15H19N3O3S — CID 4832658
ethyl 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidine-3-carboxylate (PubChem CID 4832658) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is ethyl 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4832658 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | ethyl 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=O)Nc2sccc2C#N)C1 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-21-15(20)12-4-3-6-18(9-12)10-13(19)17-14-11(8-16)5-7-22-14/h5,7,12H,2-4,6,9-10H2,1H3,(H,17,19) |
| InChIKey | FWDOKFSSHFMHEN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |