C12H13N3O3S — CID 63032930
1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 63032930) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63032930 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | N#Cc1ccsc1NC(=O)CN1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C12H13N3O3S/c13-5-8-2-4-19-11(8)14-10(16)7-15-3-1-9(6-15)12(17)18/h2,4,9H,1,3,6-7H2,(H,14,16)(H,17,18) |
| InChIKey | JVOMGHGFYQDCDU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |