C11H14N4OS — CID 43162397
N-(3-cyanothiophen-2-yl)-2-piperazin-1-ylacetamide (PubChem CID 43162397) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 43162397 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-piperazin-1-ylacetamide |
| SMILES | N#Cc1ccsc1NC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C11H14N4OS/c12-7-9-1-6-17-11(9)14-10(16)8-15-4-2-13-3-5-15/h1,6,13H,2-5,8H2,(H,14,16) |
| InChIKey | ODPFZSNYOLCTQS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |