C13H18N4OS — CID 82761956
N-(3-cyanothiophen-2-yl)-3-[(2R)-2-methylpiperazin-1-yl]propanamide (PubChem CID 82761956) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3-[(2R)-2-methylpiperazin-1-yl]propanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3-[(2R)-2-methylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 82761956 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3-[(2R)-2-methylpiperazin-1-yl]propanamide |
| SMILES | C[C@@H]1CNCCN1CCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C13H18N4OS/c1-10-9-15-4-6-17(10)5-2-12(18)16-13-11(8-14)3-7-19-13/h3,7,10,15H,2,4-6,9H2,1H3,(H,16,18)/t10-/m1/s1 |
| InChIKey | IZSFAXPBSFZAEY-SNVBAGLBSA-N |
| XLogP | 1.24 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |