C13H15N3O3S2 — CID 82906580
4-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]thiomorpholine-3-carboxylic acid (PubChem CID 82906580) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 4-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82906580 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 4-[3-[(3-cyanothiophen-2-yl)amino]-3-oxopropyl]thiomorpholine-3-carboxylic acid |
| SMILES | N#Cc1ccsc1NC(=O)CCN1CCSCC1C(=O)O |
| InChI | InChI=1S/C13H15N3O3S2/c14-7-9-2-5-21-12(9)15-11(17)1-3-16-4-6-20-8-10(16)13(18)19/h2,5,10H,1,3-4,6,8H2,(H,15,17)(H,18,19) |
| InChIKey | PETNIPLCCJDRHF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |