C19H22N4OS — CID 43001145
3-(4-benzylpiperazin-1-yl)-N-(3-cyanothiophen-2-yl)propanamide (PubChem CID 43001145) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-N-(3-cyanothiophen-2-yl)propanamide.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-N-(3-cyanothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 43001145 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-N-(3-cyanothiophen-2-yl)propanamide |
| SMILES | N#Cc1ccsc1NC(=O)CCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N4OS/c20-14-17-7-13-25-19(17)21-18(24)6-8-22-9-11-23(12-10-22)15-16-4-2-1-3-5-16/h1-5,7,13H,6,8-12,15H2,(H,21,24) |
| InChIKey | DXMHVZQTTCSBDR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |