C17H19N5OS — CID 86773779
N-(3-cyanothiophen-2-yl)-2-[3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide (PubChem CID 86773779) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 86773779 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide |
| SMILES | N#Cc1ccsc1NC(=O)CN1CCC(CNc2ccccn2)C1 |
| InChI | InChI=1S/C17H19N5OS/c18-9-14-5-8-24-17(14)21-16(23)12-22-7-4-13(11-22)10-20-15-3-1-2-6-19-15/h1-3,5-6,8,13H,4,7,10-12H2,(H,19,20)(H,21,23) |
| InChIKey | IJVNJXWECZLJKB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |