C16H25N5O2 — CID 95156695
N-(2-acetamidoethyl)-2-[(3S)-3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide (PubChem CID 95156695) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(3S)-3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(3S)-3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95156695 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(3S)-3-[(pyridin-2-ylamino)methyl]pyrrolidin-1-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)CN1CC[C@@H](CNc2ccccn2)C1 |
| InChI | InChI=1S/C16H25N5O2/c1-13(22)17-7-8-19-16(23)12-21-9-5-14(11-21)10-20-15-4-2-3-6-18-15/h2-4,6,14H,5,7-12H2,1H3,(H,17,22)(H,18,20)(H,19,23)/t14-/m0/s1 |
| InChIKey | AQGDKMWVHOTTBA-AWEZNQCLSA-N |
| XLogP | 0.07 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|