C16H26ClN3O2 — CID 119922080
2-[3-(methylaminomethyl)pyrrolidin-1-yl]-N-(2-phenoxyethyl)acetamide;hydrochloride (PubChem CID 119922080) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 2-[3-(methylaminomethyl)pyrrolidin-1-yl]-N-(2-phenoxyethyl)acetamide;hydrochloride.
| Compound Name | 2-[3-(methylaminomethyl)pyrrolidin-1-yl]-N-(2-phenoxyethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119922080 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[3-(methylaminomethyl)pyrrolidin-1-yl]-N-(2-phenoxyethyl)acetamide;hydrochloride |
| SMILES | CNCC1CCN(CC(=O)NCCOc2ccccc2)C1.Cl |
| InChI | InChI=1S/C16H25N3O2.ClH/c1-17-11-14-7-9-19(12-14)13-16(20)18-8-10-21-15-5-3-2-4-6-15;/h2-6,14,17H,7-13H2,1H3,(H,18,20);1H |
| InChIKey | FAEVNJASZDZWKD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|