C15H20ClFN2O4 — CID 119905101
1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 119905101) has the molecular formula C15H20ClFN2O4 and a molecular weight of 346.79 g/mol. Its IUPAC name is 1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119905101 |
| Molecular Formula | C15H20ClFN2O4 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(CN1CCC(C(=O)O)C1)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN2O4.ClH/c16-12-2-1-3-13(8-12)22-7-5-17-14(19)10-18-6-4-11(9-18)15(20)21;/h1-3,8,11H,4-7,9-10H2,(H,17,19)(H,20,21);1H |
| InChIKey | YHIUEOFQQPYNSU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|