C16H22ClFN2O4 — CID 119908348
1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119908348) has the molecular formula C16H22ClFN2O4 and a molecular weight of 360.81 g/mol. Its IUPAC name is 1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119908348 |
| Molecular Formula | C16H22ClFN2O4 |
| Molecular Weight | 360.81 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[2-[2-(3-fluorophenoxy)ethylamino]-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(CN1CCC(C(=O)O)CC1)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O4.ClH/c17-13-2-1-3-14(10-13)23-9-6-18-15(20)11-19-7-4-12(5-8-19)16(21)22;/h1-3,10,12H,4-9,11H2,(H,18,20)(H,21,22);1H |
| InChIKey | QHXIBWQMEIPNMW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.81 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|