C19H29ClN2O4 — CID 119907219
1-[2-oxo-2-[3-(1-phenylethoxy)propylamino]ethyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119907219) has the molecular formula C19H29ClN2O4 and a molecular weight of 384.90 g/mol. Its IUPAC name is 1-[2-oxo-2-[3-(1-phenylethoxy)propylamino]ethyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-oxo-2-[3-(1-phenylethoxy)propylamino]ethyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119907219 |
| Molecular Formula | C19H29ClN2O4 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[2-oxo-2-[3-(1-phenylethoxy)propylamino]ethyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CC(OCCCNC(=O)CN1CCC(C(=O)O)CC1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H28N2O4.ClH/c1-15(16-6-3-2-4-7-16)25-13-5-10-20-18(22)14-21-11-8-17(9-12-21)19(23)24;/h2-4,6-7,15,17H,5,8-14H2,1H3,(H,20,22)(H,23,24);1H |
| InChIKey | XUSVRHTXFCLKMI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|