C24H38N2O3 — CID 86873846
2-(4-cyclohexyloxypiperidin-1-yl)-N-[3-(1-phenylethoxy)propyl]acetamide (PubChem CID 86873846) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-(4-cyclohexyloxypiperidin-1-yl)-N-[3-(1-phenylethoxy)propyl]acetamide.
| Compound Name | 2-(4-cyclohexyloxypiperidin-1-yl)-N-[3-(1-phenylethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 86873846 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 2-(4-cyclohexyloxypiperidin-1-yl)-N-[3-(1-phenylethoxy)propyl]acetamide |
| SMILES | CC(OCCCNC(=O)CN1CCC(OC2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H38N2O3/c1-20(21-9-4-2-5-10-21)28-18-8-15-25-24(27)19-26-16-13-23(14-17-26)29-22-11-6-3-7-12-22/h2,4-5,9-10,20,22-23H,3,6-8,11-19H2,1H3,(H,25,27) |
| InChIKey | MOUIOEKGSNKZLS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|