C18H28N2OS — CID 8559793
1-cyclohexyl-3-[3-[(1S)-1-phenylethoxy]propyl]thiourea (PubChem CID 8559793) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-[(1S)-1-phenylethoxy]propyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[3-[(1S)-1-phenylethoxy]propyl]thiourea |
|---|---|
| PubChem CID | 8559793 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-cyclohexyl-3-[3-[(1S)-1-phenylethoxy]propyl]thiourea |
| SMILES | C[C@H](OCCCNC(=S)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H28N2OS/c1-15(16-9-4-2-5-10-16)21-14-8-13-19-18(22)20-17-11-6-3-7-12-17/h2,4-5,9-10,15,17H,3,6-8,11-14H2,1H3,(H2,19,20,22)/t15-/m0/s1 |
| InChIKey | PTNZRKLQPYLKOC-HNNXBMFYSA-N |
| XLogP | 3.95 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|