C17H22N2O3S — CID 86920482
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(1-phenylethoxy)propyl]acetamide (PubChem CID 86920482) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(1-phenylethoxy)propyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(1-phenylethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 86920482 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(1-phenylethoxy)propyl]acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NCCCOC(C)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-13-12-23-17(21)19(13)11-16(20)18-9-6-10-22-14(2)15-7-4-3-5-8-15/h3-5,7-8,12,14H,6,9-11H2,1-2H3,(H,18,20) |
| InChIKey | SHQWORCDTHZERF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|