C20H31N3O2 — CID 95908517
(1S,6R)-9-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]-3,9-diazabicyclo[4.2.1]nonane-3-carboxamide (PubChem CID 95908517) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (1S,6R)-9-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]-3,9-diazabicyclo[4.2.1]nonane-3-carboxamide.
| Compound Name | (1S,6R)-9-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]-3,9-diazabicyclo[4.2.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 95908517 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (1S,6R)-9-methyl-N-[3-[(1R)-1-phenylethoxy]propyl]-3,9-diazabicyclo[4.2.1]nonane-3-carboxamide |
| SMILES | C[C@@H](OCCCNC(=O)N1CC[C@H]2CC[C@@H](C1)N2C)c1ccccc1 |
| InChI | InChI=1S/C20H31N3O2/c1-16(17-7-4-3-5-8-17)25-14-6-12-21-20(24)23-13-11-18-9-10-19(15-23)22(18)2/h3-5,7-8,16,18-19H,6,9-15H2,1-2H3,(H,21,24)/t16-,18-,19+/m1/s1 |
| InChIKey | NPNICQLHNVDLHK-QRQLOZEOSA-N |
| XLogP | 3.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|