C23H30N2O4S — CID 56515058
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(1-phenylethoxy)propyl]acetamide (PubChem CID 56515058) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(1-phenylethoxy)propyl]acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(1-phenylethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 56515058 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(1-phenylethoxy)propyl]acetamide |
| SMILES | CC(OCCCNC(=O)C(c1ccccc1)N1CCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-19(20-9-4-2-5-10-20)29-16-8-13-24-23(26)22(21-11-6-3-7-12-21)25-14-17-30(27,28)18-15-25/h2-7,9-12,19,22H,8,13-18H2,1H3,(H,24,26) |
| InChIKey | OANFQHVCRXPBFJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|