C16H24N2O3S — CID 94825159
(2R)-N-butyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetamide (PubChem CID 94825159) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is (2R)-N-butyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetamide.
| Compound Name | (2R)-N-butyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 94825159 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R)-N-butyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenylacetamide |
| SMILES | CCCCNC(=O)[C@@H](c1ccccc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-2-3-9-17-16(19)15(14-7-5-4-6-8-14)18-10-12-22(20,21)13-11-18/h4-8,15H,2-3,9-13H2,1H3,(H,17,19)/t15-/m1/s1 |
| InChIKey | RHDAEWNZDUBWMH-OAHLLOKOSA-N |
| XLogP | 1.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|