C22H28N2O3S — CID 56516854
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-(2-phenylbutyl)acetamide (PubChem CID 56516854) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-(2-phenylbutyl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-(2-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 56516854 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-(2-phenylbutyl)acetamide |
| SMILES | CCC(CNC(=O)C(c1ccccc1)N1CCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-2-18(19-9-5-3-6-10-19)17-23-22(25)21(20-11-7-4-8-12-20)24-13-15-28(26,27)16-14-24/h3-12,18,21H,2,13-17H2,1H3,(H,23,25) |
| InChIKey | HEQGPZMYXPYJOX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |