C23H32N6O3S — CID 56515475
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide (PubChem CID 56515475) has the molecular formula C23H32N6O3S and a molecular weight of 472.62 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 56515475 |
| Molecular Formula | C23H32N6O3S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-phenyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)C(c1ccccc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C23H32N6O3S/c30-22(21(20-6-2-1-3-7-20)28-16-18-33(31,32)19-17-28)24-10-5-11-27-12-14-29(15-13-27)23-25-8-4-9-26-23/h1-4,6-9,21H,5,10-19H2,(H,24,30) |
| InChIKey | BFRVXOJCMKGGBH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|