C14H27Cl3N6O — CID 119901328
3-amino-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide;trihydrochloride (PubChem CID 119901328) has the molecular formula C14H27Cl3N6O and a molecular weight of 401.77 g/mol. Its IUPAC name is 3-amino-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide;trihydrochloride.
| Compound Name | 3-amino-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide;trihydrochloride |
|---|---|
| PubChem CID | 119901328 |
| Molecular Formula | C14H27Cl3N6O |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-amino-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCC(=O)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H24N6O.3ClH/c15-4-3-13(21)16-7-2-8-19-9-11-20(12-10-19)14-17-5-1-6-18-14;;;/h1,5-6H,2-4,7-12,15H2,(H,16,21);3*1H |
| InChIKey | FXXXVURVKGMLFS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|