C19H24FN5OS — CID 39540021
2-(4-fluorophenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide (PubChem CID 39540021) has the molecular formula C19H24FN5OS and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 39540021 |
| Molecular Formula | C19H24FN5OS |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
| SMILES | O=C(CSc1ccc(F)cc1)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H24FN5OS/c20-16-3-5-17(6-4-16)27-15-18(26)21-9-2-10-24-11-13-25(14-12-24)19-22-7-1-8-23-19/h1,3-8H,2,9-15H2,(H,21,26) |
| InChIKey | QUVPSJNJOWLOPO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|