C21H29N5O2S — CID 39541065
3-(4-methoxyphenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide (PubChem CID 39541065) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-(4-methoxyphenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 39541065 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfanyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]propanamide |
| SMILES | COc1ccc(SCCC(=O)NCCCN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O2S/c1-28-18-4-6-19(7-5-18)29-17-8-20(27)22-11-3-12-25-13-15-26(16-14-25)21-23-9-2-10-24-21/h2,4-7,9-10H,3,8,11-17H2,1H3,(H,22,27) |
| InChIKey | HKZQADUGEDAXQS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|