C19H25N5O2 — CID 31413337
3-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide (PubChem CID 31413337) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 3-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 31413337 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-methoxy-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCCN2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C19H25N5O2/c1-26-17-6-2-5-16(15-17)18(25)20-9-4-10-23-11-13-24(14-12-23)19-21-7-3-8-22-19/h2-3,5-8,15H,4,9-14H2,1H3,(H,20,25) |
| InChIKey | RIELPBNAKQYTMJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|