C20H28Cl2N4O2 — CID 71449110
3-methoxy-N-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]benzamide;dihydrochloride (PubChem CID 71449110) has the molecular formula C20H28Cl2N4O2 and a molecular weight of 427.38 g/mol. Its IUPAC name is 3-methoxy-N-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]benzamide;dihydrochloride.
| Compound Name | 3-methoxy-N-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 71449110 |
| Molecular Formula | C20H28Cl2N4O2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-methoxy-N-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]ethyl]benzamide;dihydrochloride |
| SMILES | COc1cccc(C(=O)NCCN2CCN(c3cc(C)ccn3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C20H26N4O2.2ClH/c1-16-6-7-21-19(14-16)24-12-10-23(11-13-24)9-8-22-20(25)17-4-3-5-18(15-17)26-2;;/h3-7,14-15H,8-13H2,1-2H3,(H,22,25);2*1H |
| InChIKey | CRCRPVGVFIWNEN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |