C15H23N3O3 — CID 82163321
N-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-methoxybenzamide (PubChem CID 82163321) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-methoxybenzamide.
| Compound Name | N-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 82163321 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCN2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-21-14-4-2-3-13(11-14)15(20)16-12-18-7-5-17(6-8-18)9-10-19/h2-4,11,19H,5-10,12H2,1H3,(H,16,20) |
| InChIKey | RHBASVCXASZXBE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |