C22H29N3O3 — CID 10572037
3-methoxy-N-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 10572037) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-methoxy-N-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 10572037 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-methoxy-N-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCN2CCN(Cc3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-27-20-8-5-7-18(16-20)22(26)23-10-11-24-12-14-25(15-13-24)17-19-6-3-4-9-21(19)28-2/h3-9,16H,10-15,17H2,1-2H3,(H,23,26) |
| InChIKey | ABYRPLMGIMQPHI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |