C19H23F2N5O2 — CID 39539519
3-(difluoromethoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide (PubChem CID 39539519) has the molecular formula C19H23F2N5O2 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 39539519 |
| Molecular Formula | C19H23F2N5O2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-(difluoromethoxy)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzamide |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H23F2N5O2/c20-18(21)28-16-5-1-4-15(14-16)17(27)22-8-3-9-25-10-12-26(13-11-25)19-23-6-2-7-24-19/h1-2,4-7,14,18H,3,8-13H2,(H,22,27) |
| InChIKey | ZMXBRTZINHTGJG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|