C23H33N7O2 — CID 55819289
N-tert-butyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoylamino]benzamide (PubChem CID 55819289) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-tert-butyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoylamino]benzamide.
| Compound Name | N-tert-butyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 55819289 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N-tert-butyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propylcarbamoylamino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=O)NCCCN2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C23H33N7O2/c1-23(2,3)28-20(31)18-7-4-8-19(17-18)27-22(32)26-11-6-12-29-13-15-30(16-14-29)21-24-9-5-10-25-21/h4-5,7-10,17H,6,11-16H2,1-3H3,(H,28,31)(H2,26,27,32) |
| InChIKey | LENKGNSNMNOOBV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|